C14H21BrO2 — CID 115779394
1-(3-bromo-4-methoxyphenyl)-3,4-dimethylpentan-2-ol (PubChem CID 115779394) has the molecular formula C14H21BrO2 and a molecular weight of 301.22 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-3,4-dimethylpentan-2-ol.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-3,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 115779394 |
| Molecular Formula | C14H21BrO2 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-3,4-dimethylpentan-2-ol |
| SMILES | COc1ccc(CC(O)C(C)C(C)C)cc1Br |
| InChI | InChI=1S/C14H21BrO2/c1-9(2)10(3)13(16)8-11-5-6-14(17-4)12(15)7-11/h5-7,9-10,13,16H,8H2,1-4H3 |
| InChIKey | SBZPHIJSKKDKLD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |