C15H12BrF3O2 — CID 115779451
2-(3-bromo-4-methoxyphenyl)-1-(2,4,6-trifluorophenyl)ethanol (PubChem CID 115779451) has the molecular formula C15H12BrF3O2 and a molecular weight of 361.16 g/mol. Its IUPAC name is 2-(3-bromo-4-methoxyphenyl)-1-(2,4,6-trifluorophenyl)ethanol.
| Compound Name | 2-(3-bromo-4-methoxyphenyl)-1-(2,4,6-trifluorophenyl)ethanol |
|---|---|
| PubChem CID | 115779451 |
| Molecular Formula | C15H12BrF3O2 |
| Molecular Weight | 361.16 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 2-(3-bromo-4-methoxyphenyl)-1-(2,4,6-trifluorophenyl)ethanol |
| SMILES | COc1ccc(CC(O)c2c(F)cc(F)cc2F)cc1Br |
| InChI | InChI=1S/C15H12BrF3O2/c1-21-14-3-2-8(4-10(14)16)5-13(20)15-11(18)6-9(17)7-12(15)19/h2-4,6-7,13,20H,5H2,1H3 |
| InChIKey | ADWHABAZNSIIPK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.16 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |