C17H17BrClFO — CID 66035027
2-bromo-4-[2-(chloromethyl)-3-(4-fluorophenyl)propyl]-1-methoxybenzene (PubChem CID 66035027) has the molecular formula C17H17BrClFO and a molecular weight of 371.68 g/mol. Its IUPAC name is 2-bromo-4-[2-(chloromethyl)-3-(4-fluorophenyl)propyl]-1-methoxybenzene.
| Compound Name | 2-bromo-4-[2-(chloromethyl)-3-(4-fluorophenyl)propyl]-1-methoxybenzene |
|---|---|
| PubChem CID | 66035027 |
| Molecular Formula | C17H17BrClFO |
| Molecular Weight | 371.68 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | 2-bromo-4-[2-(chloromethyl)-3-(4-fluorophenyl)propyl]-1-methoxybenzene |
| SMILES | COc1ccc(CC(CCl)Cc2ccc(F)cc2)cc1Br |
| InChI | InChI=1S/C17H17BrClFO/c1-21-17-7-4-13(10-16(17)18)9-14(11-19)8-12-2-5-15(20)6-3-12/h2-7,10,14H,8-9,11H2,1H3 |
| InChIKey | MHHJAXUASMQQGG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.68 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|