C17H19BrO2 — CID 66057473
2-benzyl-3-(3-bromo-4-methoxyphenyl)propan-1-ol (PubChem CID 66057473) has the molecular formula C17H19BrO2 and a molecular weight of 335.24 g/mol. Its IUPAC name is 2-benzyl-3-(3-bromo-4-methoxyphenyl)propan-1-ol.
| Compound Name | 2-benzyl-3-(3-bromo-4-methoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 66057473 |
| Molecular Formula | C17H19BrO2 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 2-benzyl-3-(3-bromo-4-methoxyphenyl)propan-1-ol |
| SMILES | COc1ccc(CC(CO)Cc2ccccc2)cc1Br |
| InChI | InChI=1S/C17H19BrO2/c1-20-17-8-7-14(11-16(17)18)10-15(12-19)9-13-5-3-2-4-6-13/h2-8,11,15,19H,9-10,12H2,1H3 |
| InChIKey | XACOXCGIIVTKRP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |