C16H14ClF3 — CID 105410889
1-[2-(chloromethyl)-3-(4-fluorophenyl)propyl]-3,5-difluorobenzene (PubChem CID 105410889) has the molecular formula C16H14ClF3 and a molecular weight of 298.74 g/mol. Its IUPAC name is 1-[2-(chloromethyl)-3-(4-fluorophenyl)propyl]-3,5-difluorobenzene.
| Compound Name | 1-[2-(chloromethyl)-3-(4-fluorophenyl)propyl]-3,5-difluorobenzene |
|---|---|
| PubChem CID | 105410889 |
| Molecular Formula | C16H14ClF3 |
| Molecular Weight | 298.74 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 1-[2-(chloromethyl)-3-(4-fluorophenyl)propyl]-3,5-difluorobenzene |
| SMILES | Fc1ccc(CC(CCl)Cc2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C16H14ClF3/c17-10-13(5-11-1-3-14(18)4-2-11)6-12-7-15(19)9-16(20)8-12/h1-4,7-9,13H,5-6,10H2 |
| InChIKey | IFXNCENIKYSGOU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.74 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|