C13H19BrO4S — CID 115779392
1-(3-bromo-4-methoxyphenyl)-3-methyl-3-methylsulfonylbutan-2-ol (PubChem CID 115779392) has the molecular formula C13H19BrO4S and a molecular weight of 351.26 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-3-methyl-3-methylsulfonylbutan-2-ol.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-3-methyl-3-methylsulfonylbutan-2-ol |
|---|---|
| PubChem CID | 115779392 |
| Molecular Formula | C13H19BrO4S |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-3-methyl-3-methylsulfonylbutan-2-ol |
| SMILES | COc1ccc(CC(O)C(C)(C)S(C)(=O)=O)cc1Br |
| InChI | InChI=1S/C13H19BrO4S/c1-13(2,19(4,16)17)12(15)8-9-5-6-11(18-3)10(14)7-9/h5-7,12,15H,8H2,1-4H3 |
| InChIKey | UXRXQUGBPOZMSW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |