C16H26BrNO — CID 115817955
1-(3-bromo-4-methoxyphenyl)-N-ethyl-3,3-dimethylpentan-2-amine (PubChem CID 115817955) has the molecular formula C16H26BrNO and a molecular weight of 328.29 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-N-ethyl-3,3-dimethylpentan-2-amine.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-N-ethyl-3,3-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 115817955 |
| Molecular Formula | C16H26BrNO |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-N-ethyl-3,3-dimethylpentan-2-amine |
| SMILES | CCNC(Cc1ccc(OC)c(Br)c1)C(C)(C)CC |
| InChI | InChI=1S/C16H26BrNO/c1-6-16(3,4)15(18-7-2)11-12-8-9-14(19-5)13(17)10-12/h8-10,15,18H,6-7,11H2,1-5H3 |
| InChIKey | BHPCAOOVSTVNPE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |