C15H17Br2NO2 — CID 115818150
1-(5-bromofuran-2-yl)-2-(3-bromo-4-methoxyphenyl)-N-ethylethanamine (PubChem CID 115818150) has the molecular formula C15H17Br2NO2 and a molecular weight of 403.11 g/mol. Its IUPAC name is 1-(5-bromofuran-2-yl)-2-(3-bromo-4-methoxyphenyl)-N-ethylethanamine.
| Compound Name | 1-(5-bromofuran-2-yl)-2-(3-bromo-4-methoxyphenyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 115818150 |
| Molecular Formula | C15H17Br2NO2 |
| Molecular Weight | 403.11 g/mol |
| Exact Mass | 400.96 |
| IUPAC Name | 1-(5-bromofuran-2-yl)-2-(3-bromo-4-methoxyphenyl)-N-ethylethanamine |
| SMILES | CCNC(Cc1ccc(OC)c(Br)c1)c1ccc(Br)o1 |
| InChI | InChI=1S/C15H17Br2NO2/c1-3-18-12(14-6-7-15(17)20-14)9-10-4-5-13(19-2)11(16)8-10/h4-8,12,18H,3,9H2,1-2H3 |
| InChIKey | RUZPQBLIJLGLKQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.11 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |