C14H21BrO4 — CID 79496145
3-(3-bromo-4-methoxyphenyl)-1,1-diethoxypropan-2-ol (PubChem CID 79496145) has the molecular formula C14H21BrO4 and a molecular weight of 333.22 g/mol. Its IUPAC name is 3-(3-bromo-4-methoxyphenyl)-1,1-diethoxypropan-2-ol.
| Compound Name | 3-(3-bromo-4-methoxyphenyl)-1,1-diethoxypropan-2-ol |
|---|---|
| PubChem CID | 79496145 |
| Molecular Formula | C14H21BrO4 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 3-(3-bromo-4-methoxyphenyl)-1,1-diethoxypropan-2-ol |
| SMILES | CCOC(OCC)C(O)Cc1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C14H21BrO4/c1-4-18-14(19-5-2)12(16)9-10-6-7-13(17-3)11(15)8-10/h6-8,12,14,16H,4-5,9H2,1-3H3 |
| InChIKey | KCQVKCNPFQORQD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|