C16H20O2 — CID 55149157
1-(3,4-dimethylphenyl)-4-(furan-2-yl)butan-2-ol (PubChem CID 55149157) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-4-(furan-2-yl)butan-2-ol.
| Compound Name | 1-(3,4-dimethylphenyl)-4-(furan-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 55149157 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-4-(furan-2-yl)butan-2-ol |
| SMILES | Cc1ccc(CC(O)CCc2ccco2)cc1C |
| InChI | InChI=1S/C16H20O2/c1-12-5-6-14(10-13(12)2)11-15(17)7-8-16-4-3-9-18-16/h3-6,9-10,15,17H,7-8,11H2,1-2H3 |
| InChIKey | NYHUZDZOKMIPSM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |