C14H15FO2 — CID 105094003
1-(4-fluoro-3-methylphenyl)-3-(furan-2-yl)propan-1-ol (PubChem CID 105094003) has the molecular formula C14H15FO2 and a molecular weight of 234.27 g/mol. Its IUPAC name is 1-(4-fluoro-3-methylphenyl)-3-(furan-2-yl)propan-1-ol.
| Compound Name | 1-(4-fluoro-3-methylphenyl)-3-(furan-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 105094003 |
| Molecular Formula | C14H15FO2 |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 1-(4-fluoro-3-methylphenyl)-3-(furan-2-yl)propan-1-ol |
| SMILES | Cc1cc(C(O)CCc2ccco2)ccc1F |
| InChI | InChI=1S/C14H15FO2/c1-10-9-11(4-6-13(10)15)14(16)7-5-12-3-2-8-17-12/h2-4,6,8-9,14,16H,5,7H2,1H3 |
| InChIKey | JRCKQSXLXFSOJR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |