C15H20N2O — CID 105300181
[1-(3,4-dimethylphenyl)-3-(furan-2-yl)propyl]hydrazine (PubChem CID 105300181) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is [1-(3,4-dimethylphenyl)-3-(furan-2-yl)propyl]hydrazine.
| Compound Name | [1-(3,4-dimethylphenyl)-3-(furan-2-yl)propyl]hydrazine |
|---|---|
| PubChem CID | 105300181 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | [1-(3,4-dimethylphenyl)-3-(furan-2-yl)propyl]hydrazine |
| SMILES | Cc1ccc(C(CCc2ccco2)NN)cc1C |
| InChI | InChI=1S/C15H20N2O/c1-11-5-6-13(10-12(11)2)15(17-16)8-7-14-4-3-9-18-14/h3-6,9-10,15,17H,7-8,16H2,1-2H3 |
| InChIKey | GJJBIMVDLYIMNC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|