C19H24O — CID 63520342
1-(3,4-dimethylphenyl)-4-(3-methylphenyl)butan-2-ol (PubChem CID 63520342) has the molecular formula C19H24O and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-4-(3-methylphenyl)butan-2-ol.
| Compound Name | 1-(3,4-dimethylphenyl)-4-(3-methylphenyl)butan-2-ol |
|---|---|
| PubChem CID | 63520342 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-4-(3-methylphenyl)butan-2-ol |
| SMILES | Cc1cccc(CCC(O)Cc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C19H24O/c1-14-5-4-6-17(11-14)9-10-19(20)13-18-8-7-15(2)16(3)12-18/h4-8,11-12,19-20H,9-10,13H2,1-3H3 |
| InChIKey | HRVPESBGQYXRKI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |