C12H18O2 — CID 83927957
4-(3,4-dimethylphenyl)butane-1,2-diol (PubChem CID 83927957) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)butane-1,2-diol.
| Compound Name | 4-(3,4-dimethylphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 83927957 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 4-(3,4-dimethylphenyl)butane-1,2-diol |
| SMILES | Cc1ccc(CCC(O)CO)cc1C |
| InChI | InChI=1S/C12H18O2/c1-9-3-4-11(7-10(9)2)5-6-12(14)8-13/h3-4,7,12-14H,5-6,8H2,1-2H3 |
| InChIKey | MPJUHVNIGUWARJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |