C13H18O2 — CID 139983559
4-(4-prop-1-en-2-ylphenyl)butane-1,2-diol (PubChem CID 139983559) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 4-(4-prop-1-en-2-ylphenyl)butane-1,2-diol.
| Compound Name | 4-(4-prop-1-en-2-ylphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 139983559 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 4-(4-prop-1-en-2-ylphenyl)butane-1,2-diol |
| SMILES | C=C(C)c1ccc(CCC(O)CO)cc1 |
| InChI | InChI=1S/C13H18O2/c1-10(2)12-6-3-11(4-7-12)5-8-13(15)9-14/h3-4,6-7,13-15H,1,5,8-9H2,2H3 |
| InChIKey | ZGOSOOBGJGIICE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |