C17H19FO3 — CID 82185811
4-[4-[(4-fluorophenyl)methoxy]phenyl]butane-1,2-diol (PubChem CID 82185811) has the molecular formula C17H19FO3 and a molecular weight of 290.33 g/mol. Its IUPAC name is 4-[4-[(4-fluorophenyl)methoxy]phenyl]butane-1,2-diol.
| Compound Name | 4-[4-[(4-fluorophenyl)methoxy]phenyl]butane-1,2-diol |
|---|---|
| PubChem CID | 82185811 |
| Molecular Formula | C17H19FO3 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 4-[4-[(4-fluorophenyl)methoxy]phenyl]butane-1,2-diol |
| SMILES | OCC(O)CCc1ccc(OCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H19FO3/c18-15-6-1-14(2-7-15)12-21-17-9-4-13(5-10-17)3-8-16(20)11-19/h1-2,4-7,9-10,16,19-20H,3,8,11-12H2 |
| InChIKey | GIQGZVUPNUBOJC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |