C13H19Br — CID 63472190
4-(3-bromopentyl)-1,2-dimethylbenzene (PubChem CID 63472190) has the molecular formula C13H19Br and a molecular weight of 255.20 g/mol. Its IUPAC name is 4-(3-bromopentyl)-1,2-dimethylbenzene.
| Compound Name | 4-(3-bromopentyl)-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 63472190 |
| Molecular Formula | C13H19Br |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 4-(3-bromopentyl)-1,2-dimethylbenzene |
| SMILES | CCC(Br)CCc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C13H19Br/c1-4-13(14)8-7-12-6-5-10(2)11(3)9-12/h5-6,9,13H,4,7-8H2,1-3H3 |
| InChIKey | PJFKPGZPLWUIJP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|