C16H24O — CID 55149919
4-cyclopentyl-1-(3-methylphenyl)butan-2-ol (PubChem CID 55149919) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is 4-cyclopentyl-1-(3-methylphenyl)butan-2-ol.
| Compound Name | 4-cyclopentyl-1-(3-methylphenyl)butan-2-ol |
|---|---|
| PubChem CID | 55149919 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 4-cyclopentyl-1-(3-methylphenyl)butan-2-ol |
| SMILES | Cc1cccc(CC(O)CCC2CCCC2)c1 |
| InChI | InChI=1S/C16H24O/c1-13-5-4-8-15(11-13)12-16(17)10-9-14-6-2-3-7-14/h4-5,8,11,14,16-17H,2-3,6-7,9-10,12H2,1H3 |
| InChIKey | POYDCWNIBHDHPT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |