C16H24OS — CID 103160784
1-cyclopentyl-3-[(3-methylphenyl)methylsulfanyl]propan-2-ol (PubChem CID 103160784) has the molecular formula C16H24OS and a molecular weight of 264.43 g/mol. Its IUPAC name is 1-cyclopentyl-3-[(3-methylphenyl)methylsulfanyl]propan-2-ol.
| Compound Name | 1-cyclopentyl-3-[(3-methylphenyl)methylsulfanyl]propan-2-ol |
|---|---|
| PubChem CID | 103160784 |
| Molecular Formula | C16H24OS |
| Molecular Weight | 264.43 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 1-cyclopentyl-3-[(3-methylphenyl)methylsulfanyl]propan-2-ol |
| SMILES | Cc1cccc(CSCC(O)CC2CCCC2)c1 |
| InChI | InChI=1S/C16H24OS/c1-13-5-4-8-15(9-13)11-18-12-16(17)10-14-6-2-3-7-14/h4-5,8-9,14,16-17H,2-3,6-7,10-12H2,1H3 |
| InChIKey | CSICUGPMJXIJJP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |