C14H21NOS — CID 103158873
1-(3-aminophenyl)sulfanyl-3-cyclopentylpropan-2-ol (PubChem CID 103158873) has the molecular formula C14H21NOS and a molecular weight of 251.39 g/mol. Its IUPAC name is 1-(3-aminophenyl)sulfanyl-3-cyclopentylpropan-2-ol.
| Compound Name | 1-(3-aminophenyl)sulfanyl-3-cyclopentylpropan-2-ol |
|---|---|
| PubChem CID | 103158873 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 1-(3-aminophenyl)sulfanyl-3-cyclopentylpropan-2-ol |
| SMILES | Nc1cccc(SCC(O)CC2CCCC2)c1 |
| InChI | InChI=1S/C14H21NOS/c15-12-6-3-7-14(9-12)17-10-13(16)8-11-4-1-2-5-11/h3,6-7,9,11,13,16H,1-2,4-5,8,10,15H2 |
| InChIKey | KXKJKHHMZLEUBG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|