C17H18BrFO — CID 105088452
1-(2-bromo-5-fluorophenyl)-4-(3-methylphenyl)butan-2-ol (PubChem CID 105088452) has the molecular formula C17H18BrFO and a molecular weight of 337.23 g/mol. Its IUPAC name is 1-(2-bromo-5-fluorophenyl)-4-(3-methylphenyl)butan-2-ol.
| Compound Name | 1-(2-bromo-5-fluorophenyl)-4-(3-methylphenyl)butan-2-ol |
|---|---|
| PubChem CID | 105088452 |
| Molecular Formula | C17H18BrFO |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 1-(2-bromo-5-fluorophenyl)-4-(3-methylphenyl)butan-2-ol |
| SMILES | Cc1cccc(CCC(O)Cc2cc(F)ccc2Br)c1 |
| InChI | InChI=1S/C17H18BrFO/c1-12-3-2-4-13(9-12)5-7-16(20)11-14-10-15(19)6-8-17(14)18/h2-4,6,8-10,16,20H,5,7,11H2,1H3 |
| InChIKey | SQRIPQHJCRMFCK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |