C15H18BrNO4S — CID 39949050
3-bromo-N-[(2R)-4-(furan-2-yl)butan-2-yl]-4-methoxybenzenesulfonamide (PubChem CID 39949050) has the molecular formula C15H18BrNO4S and a molecular weight of 388.28 g/mol. Its IUPAC name is 3-bromo-N-[(2R)-4-(furan-2-yl)butan-2-yl]-4-methoxybenzenesulfonamide.
| Compound Name | 3-bromo-N-[(2R)-4-(furan-2-yl)butan-2-yl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 39949050 |
| Molecular Formula | C15H18BrNO4S |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | 3-bromo-N-[(2R)-4-(furan-2-yl)butan-2-yl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@H](C)CCc2ccco2)cc1Br |
| InChI | InChI=1S/C15H18BrNO4S/c1-11(5-6-12-4-3-9-21-12)17-22(18,19)13-7-8-15(20-2)14(16)10-13/h3-4,7-11,17H,5-6H2,1-2H3/t11-/m1/s1 |
| InChIKey | KSPQLBWOADYHSM-LLVKDONJSA-N |
| XLogP | 3.35 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |