C14H15Br2NO3S — CID 60652421
2,5-dibromo-N-[4-(furan-2-yl)butan-2-yl]benzenesulfonamide (PubChem CID 60652421) has the molecular formula C14H15Br2NO3S and a molecular weight of 437.15 g/mol. Its IUPAC name is 2,5-dibromo-N-[4-(furan-2-yl)butan-2-yl]benzenesulfonamide.
| Compound Name | 2,5-dibromo-N-[4-(furan-2-yl)butan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 60652421 |
| Molecular Formula | C14H15Br2NO3S |
| Molecular Weight | 437.15 g/mol |
| Exact Mass | 434.91 |
| IUPAC Name | 2,5-dibromo-N-[4-(furan-2-yl)butan-2-yl]benzenesulfonamide |
| SMILES | CC(CCc1ccco1)NS(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C14H15Br2NO3S/c1-10(4-6-12-3-2-8-20-12)17-21(18,19)14-9-11(15)5-7-13(14)16/h2-3,5,7-10,17H,4,6H2,1H3 |
| InChIKey | CHMOMKZNWVDAQN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.15 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |