C13H18N4O3S — CID 103301188
N-[4-(furan-2-yl)butan-2-yl]-3-hydrazinylpyridine-2-sulfonamide (PubChem CID 103301188) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is N-[4-(furan-2-yl)butan-2-yl]-3-hydrazinylpyridine-2-sulfonamide.
| Compound Name | N-[4-(furan-2-yl)butan-2-yl]-3-hydrazinylpyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103301188 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | N-[4-(furan-2-yl)butan-2-yl]-3-hydrazinylpyridine-2-sulfonamide |
| SMILES | CC(CCc1ccco1)NS(=O)(=O)c1ncccc1NN |
| InChI | InChI=1S/C13H18N4O3S/c1-10(6-7-11-4-3-9-20-11)17-21(18,19)13-12(16-14)5-2-8-15-13/h2-5,8-10,16-17H,6-7,14H2,1H3 |
| InChIKey | GYNYUVMJEJPXNQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|