C10H18N4O3S — CID 103301625
3-hydrazinyl-N-(1-methoxybutan-2-yl)pyridine-2-sulfonamide (PubChem CID 103301625) has the molecular formula C10H18N4O3S and a molecular weight of 274.35 g/mol. Its IUPAC name is 3-hydrazinyl-N-(1-methoxybutan-2-yl)pyridine-2-sulfonamide.
| Compound Name | 3-hydrazinyl-N-(1-methoxybutan-2-yl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103301625 |
| Molecular Formula | C10H18N4O3S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 3-hydrazinyl-N-(1-methoxybutan-2-yl)pyridine-2-sulfonamide |
| SMILES | CCC(COC)NS(=O)(=O)c1ncccc1NN |
| InChI | InChI=1S/C10H18N4O3S/c1-3-8(7-17-2)14-18(15,16)10-9(13-11)5-4-6-12-10/h4-6,8,13-14H,3,7,11H2,1-2H3 |
| InChIKey | LNMWSIVJRGLXSP-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|