C7H10F2N4O2S — CID 103301882
N-(2,2-difluoroethyl)-3-hydrazinylpyridine-2-sulfonamide (PubChem CID 103301882) has the molecular formula C7H10F2N4O2S and a molecular weight of 252.25 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-3-hydrazinylpyridine-2-sulfonamide.
| Compound Name | N-(2,2-difluoroethyl)-3-hydrazinylpyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103301882 |
| Molecular Formula | C7H10F2N4O2S |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | N-(2,2-difluoroethyl)-3-hydrazinylpyridine-2-sulfonamide |
| SMILES | NNc1cccnc1S(=O)(=O)NCC(F)F |
| InChI | InChI=1S/C7H10F2N4O2S/c8-6(9)4-12-16(14,15)7-5(13-10)2-1-3-11-7/h1-3,6,12-13H,4,10H2 |
| InChIKey | BWJPYYFRGUFIJG-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|