C9H17N5O4S2 — CID 106340180
N-[2-(dimethylsulfamoyl)ethyl]-3-hydrazinylpyridine-2-sulfonamide (PubChem CID 106340180) has the molecular formula C9H17N5O4S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[2-(dimethylsulfamoyl)ethyl]-3-hydrazinylpyridine-2-sulfonamide.
| Compound Name | N-[2-(dimethylsulfamoyl)ethyl]-3-hydrazinylpyridine-2-sulfonamide |
|---|---|
| PubChem CID | 106340180 |
| Molecular Formula | C9H17N5O4S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | N-[2-(dimethylsulfamoyl)ethyl]-3-hydrazinylpyridine-2-sulfonamide |
| SMILES | CN(C)S(=O)(=O)CCNS(=O)(=O)c1ncccc1NN |
| InChI | InChI=1S/C9H17N5O4S2/c1-14(2)19(15,16)7-6-12-20(17,18)9-8(13-10)4-3-5-11-9/h3-5,12-13H,6-7,10H2,1-2H3 |
| InChIKey | RAMUNHJQJRJGEB-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|