C14H26N4O2S — CID 107816644
3-hydrazinyl-N-(7-methyloctyl)pyridine-2-sulfonamide (PubChem CID 107816644) has the molecular formula C14H26N4O2S and a molecular weight of 314.45 g/mol. Its IUPAC name is 3-hydrazinyl-N-(7-methyloctyl)pyridine-2-sulfonamide.
| Compound Name | 3-hydrazinyl-N-(7-methyloctyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 107816644 |
| Molecular Formula | C14H26N4O2S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 3-hydrazinyl-N-(7-methyloctyl)pyridine-2-sulfonamide |
| SMILES | CC(C)CCCCCCNS(=O)(=O)c1ncccc1NN |
| InChI | InChI=1S/C14H26N4O2S/c1-12(2)8-5-3-4-6-11-17-21(19,20)14-13(18-15)9-7-10-16-14/h7,9-10,12,17-18H,3-6,8,11,15H2,1-2H3 |
| InChIKey | VGZZLVVZUGYCEA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|