C11H16N6O2S — CID 103302080
3-hydrazinyl-N-[3-(1H-imidazol-2-yl)propyl]pyridine-2-sulfonamide (PubChem CID 103302080) has the molecular formula C11H16N6O2S and a molecular weight of 296.36 g/mol. Its IUPAC name is 3-hydrazinyl-N-[3-(1H-imidazol-2-yl)propyl]pyridine-2-sulfonamide.
| Compound Name | 3-hydrazinyl-N-[3-(1H-imidazol-2-yl)propyl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103302080 |
| Molecular Formula | C11H16N6O2S |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 3-hydrazinyl-N-[3-(1H-imidazol-2-yl)propyl]pyridine-2-sulfonamide |
| SMILES | NNc1cccnc1S(=O)(=O)NCCCc1ncc[nH]1 |
| InChI | InChI=1S/C11H16N6O2S/c12-17-9-3-1-5-15-11(9)20(18,19)16-6-2-4-10-13-7-8-14-10/h1,3,5,7-8,16-17H,2,4,6,12H2,(H,13,14) |
| InChIKey | FJIFAOKEHAOMDO-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|