C11H17N5O2S — CID 106081668
5-(aminomethyl)-N-[3-(1H-imidazol-2-yl)propyl]-1H-pyrrole-3-sulfonamide (PubChem CID 106081668) has the molecular formula C11H17N5O2S and a molecular weight of 283.36 g/mol. Its IUPAC name is 5-(aminomethyl)-N-[3-(1H-imidazol-2-yl)propyl]-1H-pyrrole-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-[3-(1H-imidazol-2-yl)propyl]-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106081668 |
| Molecular Formula | C11H17N5O2S |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 5-(aminomethyl)-N-[3-(1H-imidazol-2-yl)propyl]-1H-pyrrole-3-sulfonamide |
| SMILES | NCc1cc(S(=O)(=O)NCCCc2ncc[nH]2)c[nH]1 |
| InChI | InChI=1S/C11H17N5O2S/c12-7-9-6-10(8-15-9)19(17,18)16-3-1-2-11-13-4-5-14-11/h4-6,8,15-16H,1-3,7,12H2,(H,13,14) |
| InChIKey | JPIAAHZBYLIJRG-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 116.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|