C10H14N4O3S — CID 106085204
5-(aminomethyl)-N-[2-(1H-imidazol-2-yl)ethyl]furan-2-sulfonamide (PubChem CID 106085204) has the molecular formula C10H14N4O3S and a molecular weight of 270.31 g/mol. Its IUPAC name is 5-(aminomethyl)-N-[2-(1H-imidazol-2-yl)ethyl]furan-2-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-[2-(1H-imidazol-2-yl)ethyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 106085204 |
| Molecular Formula | C10H14N4O3S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 5-(aminomethyl)-N-[2-(1H-imidazol-2-yl)ethyl]furan-2-sulfonamide |
| SMILES | NCc1ccc(S(=O)(=O)NCCc2ncc[nH]2)o1 |
| InChI | InChI=1S/C10H14N4O3S/c11-7-8-1-2-10(17-8)18(15,16)14-4-3-9-12-5-6-13-9/h1-2,5-6,14H,3-4,7,11H2,(H,12,13) |
| InChIKey | HDHGPWWLDBGMFV-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |