C9H16N2O5S2 — CID 114112494
5-(aminomethyl)-N-(2-ethylsulfonylethyl)furan-2-sulfonamide (PubChem CID 114112494) has the molecular formula C9H16N2O5S2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2-ethylsulfonylethyl)furan-2-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(2-ethylsulfonylethyl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 114112494 |
| Molecular Formula | C9H16N2O5S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 5-(aminomethyl)-N-(2-ethylsulfonylethyl)furan-2-sulfonamide |
| SMILES | CCS(=O)(=O)CCNS(=O)(=O)c1ccc(CN)o1 |
| InChI | InChI=1S/C9H16N2O5S2/c1-2-17(12,13)6-5-11-18(14,15)9-4-3-8(7-10)16-9/h3-4,11H,2,5-7,10H2,1H3 |
| InChIKey | JVVWFTVFYCCQPI-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |