C9H17N3O5S2 — CID 106342936
5-(methylaminomethyl)-N-[2-(methylsulfamoyl)ethyl]furan-2-sulfonamide (PubChem CID 106342936) has the molecular formula C9H17N3O5S2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 5-(methylaminomethyl)-N-[2-(methylsulfamoyl)ethyl]furan-2-sulfonamide.
| Compound Name | 5-(methylaminomethyl)-N-[2-(methylsulfamoyl)ethyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 106342936 |
| Molecular Formula | C9H17N3O5S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 5-(methylaminomethyl)-N-[2-(methylsulfamoyl)ethyl]furan-2-sulfonamide |
| SMILES | CNCc1ccc(S(=O)(=O)NCCS(=O)(=O)NC)o1 |
| InChI | InChI=1S/C9H17N3O5S2/c1-10-7-8-3-4-9(17-8)19(15,16)12-5-6-18(13,14)11-2/h3-4,10-12H,5-7H2,1-2H3 |
| InChIKey | CFSBQNGAHHQCQS-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |