C11H17N5O3S — CID 106068159
5-(methylaminomethyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]furan-2-sulfonamide (PubChem CID 106068159) has the molecular formula C11H17N5O3S and a molecular weight of 299.36 g/mol. Its IUPAC name is 5-(methylaminomethyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]furan-2-sulfonamide.
| Compound Name | 5-(methylaminomethyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 106068159 |
| Molecular Formula | C11H17N5O3S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 5-(methylaminomethyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]furan-2-sulfonamide |
| SMILES | CNCc1ccc(S(=O)(=O)NCCCc2ncn[nH]2)o1 |
| InChI | InChI=1S/C11H17N5O3S/c1-12-7-9-4-5-11(19-9)20(17,18)15-6-2-3-10-13-8-14-16-10/h4-5,8,12,15H,2-3,6-7H2,1H3,(H,13,14,16) |
| InChIKey | UTMCHYHLABNXLV-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|