C12H18N4O3S — CID 80686304
5-(methylaminomethyl)-N-[2-(1-methylpyrazol-4-yl)ethyl]furan-2-sulfonamide (PubChem CID 80686304) has the molecular formula C12H18N4O3S and a molecular weight of 298.37 g/mol. Its IUPAC name is 5-(methylaminomethyl)-N-[2-(1-methylpyrazol-4-yl)ethyl]furan-2-sulfonamide.
| Compound Name | 5-(methylaminomethyl)-N-[2-(1-methylpyrazol-4-yl)ethyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 80686304 |
| Molecular Formula | C12H18N4O3S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 5-(methylaminomethyl)-N-[2-(1-methylpyrazol-4-yl)ethyl]furan-2-sulfonamide |
| SMILES | CNCc1ccc(S(=O)(=O)NCCc2cnn(C)c2)o1 |
| InChI | InChI=1S/C12H18N4O3S/c1-13-8-11-3-4-12(19-11)20(17,18)15-6-5-10-7-14-16(2)9-10/h3-4,7,9,13,15H,5-6,8H2,1-2H3 |
| InChIKey | NKIFJOSNNAPKPV-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |