C12H19N5O2S — CID 106073600
5-(methylaminomethyl)-N-[2-(1-methylpyrazol-4-yl)ethyl]-1H-pyrrole-3-sulfonamide (PubChem CID 106073600) has the molecular formula C12H19N5O2S and a molecular weight of 297.38 g/mol. Its IUPAC name is 5-(methylaminomethyl)-N-[2-(1-methylpyrazol-4-yl)ethyl]-1H-pyrrole-3-sulfonamide.
| Compound Name | 5-(methylaminomethyl)-N-[2-(1-methylpyrazol-4-yl)ethyl]-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106073600 |
| Molecular Formula | C12H19N5O2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 5-(methylaminomethyl)-N-[2-(1-methylpyrazol-4-yl)ethyl]-1H-pyrrole-3-sulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)NCCc2cnn(C)c2)c[nH]1 |
| InChI | InChI=1S/C12H19N5O2S/c1-13-7-11-5-12(8-14-11)20(18,19)16-4-3-10-6-15-17(2)9-10/h5-6,8-9,13-14,16H,3-4,7H2,1-2H3 |
| InChIKey | DDALGQXCQCOCAA-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |