C11H19N3O2S — CID 106024324
N-(cyclobutylmethyl)-5-(methylaminomethyl)-1H-pyrrole-3-sulfonamide (PubChem CID 106024324) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-5-(methylaminomethyl)-1H-pyrrole-3-sulfonamide.
| Compound Name | N-(cyclobutylmethyl)-5-(methylaminomethyl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106024324 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-(cyclobutylmethyl)-5-(methylaminomethyl)-1H-pyrrole-3-sulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)NCC2CCC2)c[nH]1 |
| InChI | InChI=1S/C11H19N3O2S/c1-12-7-10-5-11(8-13-10)17(15,16)14-6-9-3-2-4-9/h5,8-9,12-14H,2-4,6-7H2,1H3 |
| InChIKey | RTAMZNIKGINSSV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |