C15H25N3O2S — CID 106089998
5-[(cyclopropylamino)methyl]-N-[(3-methylcyclopentyl)methyl]-1H-pyrrole-3-sulfonamide (PubChem CID 106089998) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is 5-[(cyclopropylamino)methyl]-N-[(3-methylcyclopentyl)methyl]-1H-pyrrole-3-sulfonamide.
| Compound Name | 5-[(cyclopropylamino)methyl]-N-[(3-methylcyclopentyl)methyl]-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106089998 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 5-[(cyclopropylamino)methyl]-N-[(3-methylcyclopentyl)methyl]-1H-pyrrole-3-sulfonamide |
| SMILES | CC1CCC(CNS(=O)(=O)c2c[nH]c(CNC3CC3)c2)C1 |
| InChI | InChI=1S/C15H25N3O2S/c1-11-2-3-12(6-11)8-18-21(19,20)15-7-14(17-10-15)9-16-13-4-5-13/h7,10-13,16-18H,2-6,8-9H2,1H3 |
| InChIKey | GVKJOXCQFUMYTB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |