C14H16IN3O2S — CID 106030303
5-[(cyclopropylamino)methyl]-N-(2-iodophenyl)-1H-pyrrole-3-sulfonamide (PubChem CID 106030303) has the molecular formula C14H16IN3O2S and a molecular weight of 417.27 g/mol. Its IUPAC name is 5-[(cyclopropylamino)methyl]-N-(2-iodophenyl)-1H-pyrrole-3-sulfonamide.
| Compound Name | 5-[(cyclopropylamino)methyl]-N-(2-iodophenyl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106030303 |
| Molecular Formula | C14H16IN3O2S |
| Molecular Weight | 417.27 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | 5-[(cyclopropylamino)methyl]-N-(2-iodophenyl)-1H-pyrrole-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1I)c1c[nH]c(CNC2CC2)c1 |
| InChI | InChI=1S/C14H16IN3O2S/c15-13-3-1-2-4-14(13)18-21(19,20)12-7-11(17-9-12)8-16-10-5-6-10/h1-4,7,9-10,16-18H,5-6,8H2 |
| InChIKey | VTJRLZMJVOHYOF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|