C10H12BrN3O2S2 — CID 113225806
3-bromo-N-[2-(1-methylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 113225806) has the molecular formula C10H12BrN3O2S2 and a molecular weight of 350.26 g/mol. Its IUPAC name is 3-bromo-N-[2-(1-methylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 3-bromo-N-[2-(1-methylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113225806 |
| Molecular Formula | C10H12BrN3O2S2 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 348.96 |
| IUPAC Name | 3-bromo-N-[2-(1-methylpyrazol-4-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | Cn1cc(CCNS(=O)(=O)c2sccc2Br)cn1 |
| InChI | InChI=1S/C10H12BrN3O2S2/c1-14-7-8(6-12-14)2-4-13-18(15,16)10-9(11)3-5-17-10/h3,5-7,13H,2,4H2,1H3 |
| InChIKey | YQWSQJULMNVLFB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |