C9H10BrN3O2S2 — CID 61072946
3-bromo-N-(2-imidazol-1-ylethyl)thiophene-2-sulfonamide (PubChem CID 61072946) has the molecular formula C9H10BrN3O2S2 and a molecular weight of 336.24 g/mol. Its IUPAC name is 3-bromo-N-(2-imidazol-1-ylethyl)thiophene-2-sulfonamide.
| Compound Name | 3-bromo-N-(2-imidazol-1-ylethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61072946 |
| Molecular Formula | C9H10BrN3O2S2 |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 334.94 |
| IUPAC Name | 3-bromo-N-(2-imidazol-1-ylethyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCn1ccnc1)c1sccc1Br |
| InChI | InChI=1S/C9H10BrN3O2S2/c10-8-1-6-16-9(8)17(14,15)12-3-5-13-4-2-11-7-13/h1-2,4,6-7,12H,3,5H2 |
| InChIKey | GSKAHZWGZGIGCR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |