C9H16N2O4S2 — CID 113486780
5-(aminomethyl)-N-(1-methylsulfinylpropan-2-yl)furan-2-sulfonamide (PubChem CID 113486780) has the molecular formula C9H16N2O4S2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(1-methylsulfinylpropan-2-yl)furan-2-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(1-methylsulfinylpropan-2-yl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 113486780 |
| Molecular Formula | C9H16N2O4S2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 5-(aminomethyl)-N-(1-methylsulfinylpropan-2-yl)furan-2-sulfonamide |
| SMILES | CC(CS(C)=O)NS(=O)(=O)c1ccc(CN)o1 |
| InChI | InChI=1S/C9H16N2O4S2/c1-7(6-16(2)12)11-17(13,14)9-4-3-8(5-10)15-9/h3-4,7,11H,5-6,10H2,1-2H3 |
| InChIKey | XCULXRJMHNBYBV-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |