C10H11F4NO3S2 — CID 99839908
2,3,5,6-tetrafluoro-N-[(2R)-1-[(R)-methylsulfinyl]propan-2-yl]benzenesulfonamide (PubChem CID 99839908) has the molecular formula C10H11F4NO3S2 and a molecular weight of 333.33 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[(2R)-1-[(R)-methylsulfinyl]propan-2-yl]benzenesulfonamide.
| Compound Name | 2,3,5,6-tetrafluoro-N-[(2R)-1-[(R)-methylsulfinyl]propan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 99839908 |
| Molecular Formula | C10H11F4NO3S2 |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[(2R)-1-[(R)-methylsulfinyl]propan-2-yl]benzenesulfonamide |
| SMILES | C[C@H](C[S@@](C)=O)NS(=O)(=O)c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C10H11F4NO3S2/c1-5(4-19(2)16)15-20(17,18)10-8(13)6(11)3-7(12)9(10)14/h3,5,15H,4H2,1-2H3/t5-,19-/m1/s1 |
| InChIKey | UFTREVXHBUTACO-WZNIZKBGSA-N |
| XLogP | 1.29 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|