C13H21FN2O3S2 — CID 107326172
3-amino-4-fluoro-2,6-dimethyl-N-(4-methylsulfinylbutan-2-yl)benzenesulfonamide (PubChem CID 107326172) has the molecular formula C13H21FN2O3S2 and a molecular weight of 336.45 g/mol. Its IUPAC name is 3-amino-4-fluoro-2,6-dimethyl-N-(4-methylsulfinylbutan-2-yl)benzenesulfonamide.
| Compound Name | 3-amino-4-fluoro-2,6-dimethyl-N-(4-methylsulfinylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 107326172 |
| Molecular Formula | C13H21FN2O3S2 |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 3-amino-4-fluoro-2,6-dimethyl-N-(4-methylsulfinylbutan-2-yl)benzenesulfonamide |
| SMILES | Cc1cc(F)c(N)c(C)c1S(=O)(=O)NC(C)CCS(C)=O |
| InChI | InChI=1S/C13H21FN2O3S2/c1-8-7-11(14)12(15)10(3)13(8)21(18,19)16-9(2)5-6-20(4)17/h7,9,16H,5-6,15H2,1-4H3 |
| InChIKey | YKUDHVQYMZDFHX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|