C15H23FN2O2S — CID 107325853
3-amino-N-(1-cyclopropylbutan-2-yl)-4-fluoro-2,6-dimethylbenzenesulfonamide (PubChem CID 107325853) has the molecular formula C15H23FN2O2S and a molecular weight of 314.43 g/mol. Its IUPAC name is 3-amino-N-(1-cyclopropylbutan-2-yl)-4-fluoro-2,6-dimethylbenzenesulfonamide.
| Compound Name | 3-amino-N-(1-cyclopropylbutan-2-yl)-4-fluoro-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107325853 |
| Molecular Formula | C15H23FN2O2S |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 3-amino-N-(1-cyclopropylbutan-2-yl)-4-fluoro-2,6-dimethylbenzenesulfonamide |
| SMILES | CCC(CC1CC1)NS(=O)(=O)c1c(C)cc(F)c(N)c1C |
| InChI | InChI=1S/C15H23FN2O2S/c1-4-12(8-11-5-6-11)18-21(19,20)15-9(2)7-13(16)14(17)10(15)3/h7,11-12,18H,4-6,8,17H2,1-3H3 |
| InChIKey | GAAWIYNEXZRMNU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|