C12H13F4NO4S — CID 122069952
4-methyl-2-[(2,3,5,6-tetrafluorophenyl)sulfonylamino]pentanoic acid (PubChem CID 122069952) has the molecular formula C12H13F4NO4S and a molecular weight of 343.30 g/mol. Its IUPAC name is 4-methyl-2-[(2,3,5,6-tetrafluorophenyl)sulfonylamino]pentanoic acid.
| Compound Name | 4-methyl-2-[(2,3,5,6-tetrafluorophenyl)sulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 122069952 |
| Molecular Formula | C12H13F4NO4S |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 4-methyl-2-[(2,3,5,6-tetrafluorophenyl)sulfonylamino]pentanoic acid |
| SMILES | CC(C)CC(NS(=O)(=O)c1c(F)c(F)cc(F)c1F)C(=O)O |
| InChI | InChI=1S/C12H13F4NO4S/c1-5(2)3-8(12(18)19)17-22(20,21)11-9(15)6(13)4-7(14)10(11)16/h4-5,8,17H,3H2,1-2H3,(H,18,19) |
| InChIKey | WSYFMVNEPOHKPN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|