C12H14Cl2FNO4S — CID 122069288
(2R)-2-[(2,6-dichloro-4-fluorophenyl)sulfonylamino]-4-methylpentanoic acid (PubChem CID 122069288) has the molecular formula C12H14Cl2FNO4S and a molecular weight of 358.22 g/mol. Its IUPAC name is (2R)-2-[(2,6-dichloro-4-fluorophenyl)sulfonylamino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[(2,6-dichloro-4-fluorophenyl)sulfonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122069288 |
| Molecular Formula | C12H14Cl2FNO4S |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | (2R)-2-[(2,6-dichloro-4-fluorophenyl)sulfonylamino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NS(=O)(=O)c1c(Cl)cc(F)cc1Cl)C(=O)O |
| InChI | InChI=1S/C12H14Cl2FNO4S/c1-6(2)3-10(12(17)18)16-21(19,20)11-8(13)4-7(15)5-9(11)14/h4-6,10,16H,3H2,1-2H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | ZYIBHWACIPLMAR-SNVBAGLBSA-N |
| XLogP | 2.91 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |