C11H12Cl2FNO4S — CID 122067838
2-[(2,6-dichloro-4-fluorophenyl)sulfonylamino]-3-methylbutanoic acid (PubChem CID 122067838) has the molecular formula C11H12Cl2FNO4S and a molecular weight of 344.19 g/mol. Its IUPAC name is 2-[(2,6-dichloro-4-fluorophenyl)sulfonylamino]-3-methylbutanoic acid.
| Compound Name | 2-[(2,6-dichloro-4-fluorophenyl)sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 122067838 |
| Molecular Formula | C11H12Cl2FNO4S |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 2-[(2,6-dichloro-4-fluorophenyl)sulfonylamino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NS(=O)(=O)c1c(Cl)cc(F)cc1Cl)C(=O)O |
| InChI | InChI=1S/C11H12Cl2FNO4S/c1-5(2)9(11(16)17)15-20(18,19)10-7(12)3-6(14)4-8(10)13/h3-5,9,15H,1-2H3,(H,16,17) |
| InChIKey | CDRTUDXINZOSBD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |