C20H33NO4S — CID 25036140
3-methyl-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]butanoic acid (PubChem CID 25036140) has the molecular formula C20H33NO4S and a molecular weight of 383.55 g/mol. Its IUPAC name is 3-methyl-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]butanoic acid.
| Compound Name | 3-methyl-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 25036140 |
| Molecular Formula | C20H33NO4S |
| Molecular Weight | 383.55 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 3-methyl-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]butanoic acid |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)NC(C(=O)O)C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C20H33NO4S/c1-11(2)15-9-16(12(3)4)19(17(10-15)13(5)6)26(24,25)21-18(14(7)8)20(22)23/h9-14,18,21H,1-8H3,(H,22,23) |
| InChIKey | CGGQNJYHSYVCKZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |