About N-methylmethanesulfonamide;N-methyl-2,4,6-tri(propan-2-yl)benzenesulfonamide
N-methylmethanesulfonamide;N-methyl-2,4,6-tri(propan-2-yl)benzenesulfonamide (PubChem CID 123143002) has the molecular formula C18H34N2O4S2
and a molecular weight of 406.61 g/mol. Its IUPAC name is N-methylmethanesulfonamide;N-methyl-2,4,6-tri(propan-2-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-methylmethanesulfonamide;N-methyl-2,4,6-tri(propan-2-yl)benzenesulfonamide |
| PubChem CID | 123143002 |
| Molecular Formula | C18H34N2O4S2 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | N-methylmethanesulfonamide;N-methyl-2,4,6-tri(propan-2-yl)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1c(C(C)C)cc(C(C)C)cc1C(C)C.CNS(C)(=O)=O |
| InChI | InChI=1S/C16H27NO2S.C2H7NO2S/c1-10(2)13-8-14(11(3)4)16(20(18,19)17-7)15(9-13)12(5)6;1-3-6(2,4)5/h8-12,17H,1-7H3;3H,1-2H3 |
| InChIKey | OOGNPXMTIWQWSA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methylmethanesulfonamide;N-methyl-2,4,6-tri(propan-2-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanesulfonamide;N-methyl-2,4,6-tri(propan-2-yl)benzenesulfonamide?
The IUPAC name of N-methylmethanesulfonamide;N-methyl-2,4,6-tri(propan-2-yl)benzenesulfonamide (CID 123143002) is N-methylmethanesulfonamide;N-methyl-2,4,6-tri(propan-2-yl)benzenesulfonamide.
What is the SMILES notation for N-methylmethanesulfonamide;N-methyl-2,4,6-tri(propan-2-yl)benzenesulfonamide?
The canonical SMILES for N-methylmethanesulfonamide;N-methyl-2,4,6-tri(propan-2-yl)benzenesulfonamide is CNS(=O)(=O)c1c(C(C)C)cc(C(C)C)cc1C(C)C.CNS(C)(=O)=O.
What is the InChIKey of N-methylmethanesulfonamide;N-methyl-2,4,6-tri(propan-2-yl)benzenesulfonamide?
The InChIKey is OOGNPXMTIWQWSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO2S.C2H7NO2S/c1-10(2)13-8-14(11(3)4)16(20(18,19)17-7)15(9-13)12(5)6;1-3-6(2,4)5/h8-12,17H,1-7H3;3H,1-2H3.
What are the key properties of N-methylmethanesulfonamide;N-methyl-2,4,6-tri(propan-2-yl)benzenesulfonamide?
N-methylmethanesulfonamide;N-methyl-2,4,6-tri(propan-2-yl)benzenesulfonamide has a molecular weight of 406.61 g/mol, XLogP of 3.13, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanesulfonamide;N-methyl-2,4,6-tri(propan-2-yl)benzenesulfonamide is sourced from PubChem (CID 123143002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).